About (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate
(4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate (PubChem CID 59197112) has the molecular formula C32H32O11
and a molecular weight of 592.60 g/mol. Its IUPAC name is (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate.
Molecular Properties
| Compound Name | (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate |
| PubChem CID | 59197112 |
| Molecular Formula | C32H32O11 |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate |
| SMILES | CCC(=O)OCCCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OC(C)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H32O11/c1-3-29(34)38-20-6-4-5-7-21-39-32(37)43-28-14-10-24(11-15-28)30(35)41-26-12-8-23(9-13-26)31(36)42-27-18-16-25(17-19-27)40-22(2)33/h8-19H,3-7,20-21H2,1-2H3 |
| InChIKey | YTBZCIDGJMJFIK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate?
The IUPAC name of (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate (CID 59197112) is (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate.
What is the SMILES notation for (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate?
The canonical SMILES for (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate is CCC(=O)OCCCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OC(C)=O)cc3)cc2)cc1.
What is the InChIKey of (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate?
The InChIKey is YTBZCIDGJMJFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32O11/c1-3-29(34)38-20-6-4-5-7-21-39-32(37)43-28-14-10-24(11-15-28)30(35)41-26-12-8-23(9-13-26)31(36)42-27-18-16-25(17-19-27)40-22(2)33/h8-19H,3-7,20-21H2,1-2H3.
What are the key properties of (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate?
(4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate has a molecular weight of 592.60 g/mol, XLogP of 6.08, 14 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxyphenyl) 4-[4-(6-propanoyloxyhexoxycarbonyloxy)benzoyl]oxybenzoate is sourced from PubChem (CID 59197112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).