About (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate
(4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate (PubChem CID 101128329) has the molecular formula C23H28O5
and a molecular weight of 384.47 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate |
| PubChem CID | 101128329 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate |
| SMILES | CCC(=O)OCCCCCCc1ccc(C(=O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H28O5/c1-3-22(24)27-17-7-5-4-6-8-18-9-11-19(12-10-18)23(25)28-21-15-13-20(26-2)14-16-21/h9-16H,3-8,17H2,1-2H3 |
| InChIKey | YDIPYMJWYSKZFU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate?
The IUPAC name of (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate (CID 101128329) is (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate.
What is the SMILES notation for (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate?
The canonical SMILES for (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate is CCC(=O)OCCCCCCc1ccc(C(=O)Oc2ccc(OC)cc2)cc1.
What is the InChIKey of (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate?
The InChIKey is YDIPYMJWYSKZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O5/c1-3-22(24)27-17-7-5-4-6-8-18-9-11-19(12-10-18)23(25)28-21-15-13-20(26-2)14-16-21/h9-16H,3-8,17H2,1-2H3.
What are the key properties of (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate?
(4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate has a molecular weight of 384.47 g/mol, XLogP of 4.97, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 4-(6-propanoyloxyhexyl)benzoate is sourced from PubChem (CID 101128329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).