About [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate
[4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate (PubChem CID 143562432) has the molecular formula C29H40O6
and a molecular weight of 484.63 g/mol. Its IUPAC name is [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate.
Molecular Properties
| Compound Name | [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate |
| PubChem CID | 143562432 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCOC(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C29H40O6/c1-3-5-6-7-10-21-32-25-15-13-24(14-16-25)29(31)35-27-19-17-26(18-20-27)33-22-11-8-9-12-23-34-28(30)4-2/h13-20H,3-12,21-23H2,1-2H3 |
| InChIKey | KHYJRUNYOGQCRI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate?
The IUPAC name of [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate (CID 143562432) is [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate.
What is the SMILES notation for [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate?
The canonical SMILES for [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate is CCCCCCCOc1ccc(C(=O)Oc2ccc(OCCCCCCOC(=O)CC)cc2)cc1.
What is the InChIKey of [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate?
The InChIKey is KHYJRUNYOGQCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40O6/c1-3-5-6-7-10-21-32-25-15-13-24(14-16-25)29(31)35-27-19-17-26(18-20-27)33-22-11-8-9-12-23-34-28(30)4-2/h13-20H,3-12,21-23H2,1-2H3.
What are the key properties of [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate?
[4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate has a molecular weight of 484.63 g/mol, XLogP of 7.15, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-propanoyloxyhexoxy)phenyl] 4-heptoxybenzoate is sourced from PubChem (CID 143562432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).