About 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate
6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate (PubChem CID 54565430) has the molecular formula C24H26O8
and a molecular weight of 442.46 g/mol. Its IUPAC name is 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate.
Molecular Properties
| Compound Name | 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate |
| PubChem CID | 54565430 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)OCCCCCCOC(=O)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C24H26O8/c1-17(25)31-21-11-7-19(8-12-21)23(27)29-15-5-3-4-6-16-30-24(28)20-9-13-22(14-10-20)32-18(2)26/h7-14H,3-6,15-16H2,1-2H3 |
| InChIKey | ZTMHEVIXXYTKEL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate?
The IUPAC name of 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate (CID 54565430) is 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate.
What is the SMILES notation for 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate?
The canonical SMILES for 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate is CC(=O)Oc1ccc(C(=O)OCCCCCCOC(=O)c2ccc(OC(C)=O)cc2)cc1.
What is the InChIKey of 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate?
The InChIKey is ZTMHEVIXXYTKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O8/c1-17(25)31-21-11-7-19(8-12-21)23(27)29-15-5-3-4-6-16-30-24(28)20-9-13-22(14-10-20)32-18(2)26/h7-14H,3-6,15-16H2,1-2H3.
What are the key properties of 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate?
6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate has a molecular weight of 442.46 g/mol, XLogP of 4.11, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-acetyloxybenzoyl)oxyhexyl 4-acetyloxybenzoate is sourced from PubChem (CID 54565430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).