C39H42B2O14 — CID 161190577
CID 161190577 (PubChem CID 161190577) has the molecular formula C39H42B2O14 and a molecular weight of 756.38 g/mol.
| Compound Name | CID 161190577 |
|---|---|
| PubChem CID | 161190577 |
| Molecular Formula | C39H42B2O14 |
| Molecular Weight | 756.38 g/mol |
| Exact Mass | 756.28 |
| IUPAC Name | — |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)OC)cc1.C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C)cc2C)cc1.[B][B] |
| InChI | InChI=1S/C23H24O7.C16H18O7.B2/c1-4-21(24)27-13-5-6-14-28-23(26)29-19-10-8-18(9-11-19)22(25)30-20-12-7-16(2)15-17(20)3;1-3-14(17)21-10-4-5-11-22-16(19)23-13-8-6-12(7-9-13)15(18)20-2;1-2/h4,7-12,15H,1,5-6,13-14H2,2-3H3;3,6-9H,1,4-5,10-11H2,2H3; |
| InChIKey | WNKWEAQZBMKWPM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.38 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|