C24H27N3O6 — CID 91050518
1-N,3-N,5-N-tris(3-oxopent-4-enyl)benzene-1,3,5-tricarboxamide (PubChem CID 91050518) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(3-oxopent-4-enyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(3-oxopent-4-enyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 91050518 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-N,3-N,5-N-tris(3-oxopent-4-enyl)benzene-1,3,5-tricarboxamide |
| SMILES | C=CC(=O)CCNC(=O)c1cc(C(=O)NCCC(=O)C=C)cc(C(=O)NCCC(=O)C=C)c1 |
| InChI | InChI=1S/C24H27N3O6/c1-4-19(28)7-10-25-22(31)16-13-17(23(32)26-11-8-20(29)5-2)15-18(14-16)24(33)27-12-9-21(30)6-3/h4-6,13-15H,1-3,7-12H2,(H,25,31)(H,26,32)(H,27,33) |
| InChIKey | HMUACHCGMASFEX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|