C45H69N3O3Si3 — CID 11767918
1-N,3-N,5-N-tris[3-tris(prop-2-enyl)silylpropyl]benzene-1,3,5-tricarboxamide (PubChem CID 11767918) has the molecular formula C45H69N3O3Si3 and a molecular weight of 784.32 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[3-tris(prop-2-enyl)silylpropyl]benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris[3-tris(prop-2-enyl)silylpropyl]benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 11767918 |
| Molecular Formula | C45H69N3O3Si3 |
| Molecular Weight | 784.32 g/mol |
| Exact Mass | 783.46 |
| IUPAC Name | 1-N,3-N,5-N-tris[3-tris(prop-2-enyl)silylpropyl]benzene-1,3,5-tricarboxamide |
| SMILES | C=CC[Si](CC=C)(CC=C)CCCNC(=O)c1cc(C(=O)NCCC[Si](CC=C)(CC=C)CC=C)cc(C(=O)NCCC[Si](CC=C)(CC=C)CC=C)c1 |
| InChI | InChI=1S/C45H69N3O3Si3/c1-10-25-52(26-11-2,27-12-3)34-19-22-46-43(49)40-37-41(44(50)47-23-20-35-53(28-13-4,29-14-5)30-15-6)39-42(38-40)45(51)48-24-21-36-54(31-16-7,32-17-8)33-18-9/h10-18,37-39H,1-9,19-36H2,(H,46,49)(H,47,50)(H,48,51) |
| InChIKey | SYHOPFPJQITMDD-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.32 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|