C23H32Cl2N4O5 — CID 11016731
1-N,3-N-bis[4-[(2-chloroacetyl)amino]butyl]-5-prop-2-enoxybenzene-1,3-dicarboxamide (PubChem CID 11016731) has the molecular formula C23H32Cl2N4O5 and a molecular weight of 515.44 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[(2-chloroacetyl)amino]butyl]-5-prop-2-enoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[(2-chloroacetyl)amino]butyl]-5-prop-2-enoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 11016731 |
| Molecular Formula | C23H32Cl2N4O5 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 1-N,3-N-bis[4-[(2-chloroacetyl)amino]butyl]-5-prop-2-enoxybenzene-1,3-dicarboxamide |
| SMILES | C=CCOc1cc(C(=O)NCCCCNC(=O)CCl)cc(C(=O)NCCCCNC(=O)CCl)c1 |
| InChI | InChI=1S/C23H32Cl2N4O5/c1-2-11-34-19-13-17(22(32)28-9-5-3-7-26-20(30)15-24)12-18(14-19)23(33)29-10-6-4-8-27-21(31)16-25/h2,12-14H,1,3-11,15-16H2,(H,26,30)(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | GNGVALPHZCYFRE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|