C15H18F3NO3 — CID 86930576
4-prop-2-enoxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide (PubChem CID 86930576) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-prop-2-enoxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide.
| Compound Name | 4-prop-2-enoxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 86930576 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-prop-2-enoxy-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
| SMILES | C=CCOc1ccc(C(=O)NCCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO3/c1-2-9-22-13-6-4-12(5-7-13)14(20)19-8-3-10-21-11-15(16,17)18/h2,4-7H,1,3,8-11H2,(H,19,20) |
| InChIKey | NNPKLFOJZWQDHD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|