C18H20ClFN4O3 — CID 167012299
4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-(pyridazin-3-ylmethyl)butanamide (PubChem CID 167012299) has the molecular formula C18H20ClFN4O3 and a molecular weight of 394.83 g/mol. Its IUPAC name is 4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-(pyridazin-3-ylmethyl)butanamide.
| Compound Name | 4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-(pyridazin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 167012299 |
| Molecular Formula | C18H20ClFN4O3 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-(pyridazin-3-ylmethyl)butanamide |
| SMILES | C=C/C(=C\C(F)=C\Cl)OCC(=O)NCCC(=C)C(=O)NCc1cccnn1 |
| InChI | InChI=1S/C18H20ClFN4O3/c1-3-16(9-14(20)10-19)27-12-17(25)21-8-6-13(2)18(26)22-11-15-5-4-7-23-24-15/h3-5,7,9-10H,1-2,6,8,11-12H2,(H,21,25)(H,22,26)/b14-10-,16-9+ |
| InChIKey | CLLKQZZEOURDCF-ZMWMZOIBSA-N |
| XLogP | 2.29 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|