About ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide
ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide (PubChem CID 142302144) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide |
| PubChem CID | 142302144 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide |
| SMILES | C=C/C=C(\C=C)NC(=O)c1cncc(C)c1.CC |
| InChI | InChI=1S/C13H14N2O.C2H6/c1-4-6-12(5-2)15-13(16)11-7-10(3)8-14-9-11;1-2/h4-9H,1-2H2,3H3,(H,15,16);1-2H3/b12-6+; |
| InChIKey | NLHABDFBQHIPSN-WXIWBVQFSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide?
The IUPAC name of ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide (CID 142302144) is ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide.
What is the SMILES notation for ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide?
The canonical SMILES for ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide is C=C/C=C(\C=C)NC(=O)c1cncc(C)c1.CC.
What is the InChIKey of ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide?
The InChIKey is NLHABDFBQHIPSN-WXIWBVQFSA-N. The full InChI is InChI=1S/C13H14N2O.C2H6/c1-4-6-12(5-2)15-13(16)11-7-10(3)8-14-9-11;1-2/h4-9H,1-2H2,3H3,(H,15,16);1-2H3/b12-6+;.
What are the key properties of ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide?
ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide has a molecular weight of 244.34 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine-3-carboxamide is sourced from PubChem (CID 142302144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).