C16H22ClNO — CID 142490411
3-(4-chlorophenyl)-N-[(4S)-4-methylhex-5-enyl]propanamide (PubChem CID 142490411) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(4S)-4-methylhex-5-enyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(4S)-4-methylhex-5-enyl]propanamide |
|---|---|
| PubChem CID | 142490411 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(4S)-4-methylhex-5-enyl]propanamide |
| SMILES | C=C[C@@H](C)CCCNC(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO/c1-3-13(2)5-4-12-18-16(19)11-8-14-6-9-15(17)10-7-14/h3,6-7,9-10,13H,1,4-5,8,11-12H2,2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | XLWNHJLUJSUUCU-CYBMUJFWSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|