C9H16N2O — CID 123402459
2-(but-3-en-2-ylideneamino)-N-propylacetamide (PubChem CID 123402459) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(but-3-en-2-ylideneamino)-N-propylacetamide.
| Compound Name | 2-(but-3-en-2-ylideneamino)-N-propylacetamide |
|---|---|
| PubChem CID | 123402459 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(but-3-en-2-ylideneamino)-N-propylacetamide |
| SMILES | C=C/C(C)=N/CC(=O)NCCC |
| InChI | InChI=1S/C9H16N2O/c1-4-6-10-9(12)7-11-8(3)5-2/h5H,2,4,6-7H2,1,3H3,(H,10,12)/b11-8+ |
| InChIKey | LVSLQJLRMGTNEQ-DHZHZOJOSA-N |
| XLogP | 1.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|