C12H20N2O4 — CID 171651417
[2-oxo-2-[2-(pentanoylamino)ethylamino]ethyl] prop-2-enoate (PubChem CID 171651417) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is [2-oxo-2-[2-(pentanoylamino)ethylamino]ethyl] prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(pentanoylamino)ethylamino]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 171651417 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [2-oxo-2-[2-(pentanoylamino)ethylamino]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)NCCNC(=O)CCCC |
| InChI | InChI=1S/C12H20N2O4/c1-3-5-6-10(15)13-7-8-14-11(16)9-18-12(17)4-2/h4H,2-3,5-9H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | IOSPUNQBBKLPPH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|