C20H28ClFN2O4 — CID 142586327
(2E)-N-[3-[[2-[(1E,3E)-4-chlorobuta-1,3-dienoxy]acetyl]amino]but-3-enyl]-4-methoxypenta-2,4-dienamide;ethene;fluoroethene (PubChem CID 142586327) has the molecular formula C20H28ClFN2O4 and a molecular weight of 414.91 g/mol. Its IUPAC name is (2E)-N-[3-[[2-[(1E,3E)-4-chlorobuta-1,3-dienoxy]acetyl]amino]but-3-enyl]-4-methoxypenta-2,4-dienamide;ethene;fluoroethene.
| Compound Name | (2E)-N-[3-[[2-[(1E,3E)-4-chlorobuta-1,3-dienoxy]acetyl]amino]but-3-enyl]-4-methoxypenta-2,4-dienamide;ethene;fluoroethene |
|---|---|
| PubChem CID | 142586327 |
| Molecular Formula | C20H28ClFN2O4 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (2E)-N-[3-[[2-[(1E,3E)-4-chlorobuta-1,3-dienoxy]acetyl]amino]but-3-enyl]-4-methoxypenta-2,4-dienamide;ethene;fluoroethene |
| SMILES | C=C.C=C(CCNC(=O)/C=C/C(=C)OC)NC(=O)CO/C=C/C=C/Cl.C=CF |
| InChI | InChI=1S/C16H21ClN2O4.C2H3F.C2H4/c1-13(19-16(21)12-23-11-5-4-9-17)8-10-18-15(20)7-6-14(2)22-3;1-2-3;1-2/h4-7,9,11H,1-2,8,10,12H2,3H3,(H,18,20)(H,19,21);2H,1H2;1-2H2/b7-6+,9-4+,11-5+;; |
| InChIKey | VJNDRDGSYVQADL-NBLLLTSZSA-N |
| XLogP | 4.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|