C8H14N2O2 — CID 166753302
2-[(1E)-buta-1,3-dienoxy]-N'-ethylacetohydrazide (PubChem CID 166753302) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienoxy]-N'-ethylacetohydrazide.
| Compound Name | 2-[(1E)-buta-1,3-dienoxy]-N'-ethylacetohydrazide |
|---|---|
| PubChem CID | 166753302 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienoxy]-N'-ethylacetohydrazide |
| SMILES | C=C/C=C/OCC(=O)NNCC |
| InChI | InChI=1S/C8H14N2O2/c1-3-5-6-12-7-8(11)10-9-4-2/h3,5-6,9H,1,4,7H2,2H3,(H,10,11)/b6-5+ |
| InChIKey | IWQVZVOVWHPZGZ-AATRIKPKSA-N |
| XLogP | 0.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|