C19H22ClFN4O4 — CID 170084456
4-[[2-[(1E,3E)-4-chloro-5-fluorohexa-1,3,5-trienoxy]acetyl]amino]-N-(5-methoxypyrimidin-2-yl)-2-methylpent-4-enamide (PubChem CID 170084456) has the molecular formula C19H22ClFN4O4 and a molecular weight of 424.86 g/mol. Its IUPAC name is 4-[[2-[(1E,3E)-4-chloro-5-fluorohexa-1,3,5-trienoxy]acetyl]amino]-N-(5-methoxypyrimidin-2-yl)-2-methylpent-4-enamide.
| Compound Name | 4-[[2-[(1E,3E)-4-chloro-5-fluorohexa-1,3,5-trienoxy]acetyl]amino]-N-(5-methoxypyrimidin-2-yl)-2-methylpent-4-enamide |
|---|---|
| PubChem CID | 170084456 |
| Molecular Formula | C19H22ClFN4O4 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[[2-[(1E,3E)-4-chloro-5-fluorohexa-1,3,5-trienoxy]acetyl]amino]-N-(5-methoxypyrimidin-2-yl)-2-methylpent-4-enamide |
| SMILES | C=C(CC(C)C(=O)Nc1ncc(OC)cn1)NC(=O)CO/C=C/C=C(/Cl)C(=C)F |
| InChI | InChI=1S/C19H22ClFN4O4/c1-12(18(27)25-19-22-9-15(28-4)10-23-19)8-13(2)24-17(26)11-29-7-5-6-16(20)14(3)21/h5-7,9-10,12H,2-3,8,11H2,1,4H3,(H,24,26)(H,22,23,25,27)/b7-5+,16-6+ |
| InChIKey | YFYKSSXQPZWXHP-YNNHOZKOSA-N |
| XLogP | 3.22 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|