C8H11N3O3 — CID 4159152
ethyl N-(5-methoxypyrimidin-2-yl)carbamate (PubChem CID 4159152) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl N-(5-methoxypyrimidin-2-yl)carbamate.
| Compound Name | ethyl N-(5-methoxypyrimidin-2-yl)carbamate |
|---|---|
| PubChem CID | 4159152 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | ethyl N-(5-methoxypyrimidin-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1ncc(OC)cn1 |
| InChI | InChI=1S/C8H11N3O3/c1-3-14-8(12)11-7-9-4-6(13-2)5-10-7/h4-5H,3H2,1-2H3,(H,9,10,11,12) |
| InChIKey | DLKSIZOWABSKKH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |