C17H32N2O2S — CID 118143798
N-[3-(2-methylprop-2-enoylamino)propyl]-10-sulfanyldecanamide (PubChem CID 118143798) has the molecular formula C17H32N2O2S and a molecular weight of 328.52 g/mol. Its IUPAC name is N-[3-(2-methylprop-2-enoylamino)propyl]-10-sulfanyldecanamide.
| Compound Name | N-[3-(2-methylprop-2-enoylamino)propyl]-10-sulfanyldecanamide |
|---|---|
| PubChem CID | 118143798 |
| Molecular Formula | C17H32N2O2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[3-(2-methylprop-2-enoylamino)propyl]-10-sulfanyldecanamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)CCCCCCCCCS |
| InChI | InChI=1S/C17H32N2O2S/c1-15(2)17(21)19-13-10-12-18-16(20)11-8-6-4-3-5-7-9-14-22/h22H,1,3-14H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | QKFWJGILNXQATP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|