C12H22N2O2S — CID 118143471
N-[3-(prop-2-enoylamino)propyl]-6-sulfanylhexanamide (PubChem CID 118143471) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[3-(prop-2-enoylamino)propyl]-6-sulfanylhexanamide.
| Compound Name | N-[3-(prop-2-enoylamino)propyl]-6-sulfanylhexanamide |
|---|---|
| PubChem CID | 118143471 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[3-(prop-2-enoylamino)propyl]-6-sulfanylhexanamide |
| SMILES | C=CC(=O)NCCCNC(=O)CCCCCS |
| InChI | InChI=1S/C12H22N2O2S/c1-2-11(15)13-8-6-9-14-12(16)7-4-3-5-10-17/h2,17H,1,3-10H2,(H,13,15)(H,14,16) |
| InChIKey | RMIDTYLIZVMAEH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|