C12H17ClS — CID 123179986
2-(1-chloroprop-1-enylsulfanyl)-3-methylocta-1,3,5-triene (PubChem CID 123179986) has the molecular formula C12H17ClS and a molecular weight of 228.79 g/mol. Its IUPAC name is 2-(1-chloroprop-1-enylsulfanyl)-3-methylocta-1,3,5-triene.
| Compound Name | 2-(1-chloroprop-1-enylsulfanyl)-3-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 123179986 |
| Molecular Formula | C12H17ClS |
| Molecular Weight | 228.79 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-(1-chloroprop-1-enylsulfanyl)-3-methylocta-1,3,5-triene |
| SMILES | C=C(SC(Cl)=CC)C(C)=CC=CCC |
| InChI | InChI=1S/C12H17ClS/c1-5-7-8-9-10(3)11(4)14-12(13)6-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | GWGLRRAPXGQDLC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|