C12H18O2 — CID 91698107
[(2E,4E)-hepta-2,4-dienyl] (E)-2-methylbut-2-enoate (PubChem CID 91698107) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is [(2E,4E)-hepta-2,4-dienyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(2E,4E)-hepta-2,4-dienyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 91698107 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | [(2E,4E)-hepta-2,4-dienyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC/C=C/C=C/CC |
| InChI | InChI=1S/C12H18O2/c1-4-6-7-8-9-10-14-12(13)11(3)5-2/h5-9H,4,10H2,1-3H3/b7-6+,9-8+,11-5+ |
| InChIKey | AIYDWCYFNRMOHE-MAWKFJPGSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|