C22H36O — CID 142259373
ethane;ethene;(1E,5Z)-4-methylidene-1-phenylhepta-1,5-dien-3-one (PubChem CID 142259373) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;ethene;(1E,5Z)-4-methylidene-1-phenylhepta-1,5-dien-3-one.
| Compound Name | ethane;ethene;(1E,5Z)-4-methylidene-1-phenylhepta-1,5-dien-3-one |
|---|---|
| PubChem CID | 142259373 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | ethane;ethene;(1E,5Z)-4-methylidene-1-phenylhepta-1,5-dien-3-one |
| SMILES | C=C.C=C(/C=C\C)C(=O)/C=C/c1ccccc1.CC.CC.CC |
| InChI | InChI=1S/C14H14O.3C2H6.C2H4/c1-3-7-12(2)14(15)11-10-13-8-5-4-6-9-13;4*1-2/h3-11H,2H2,1H3;3*1-2H3;1-2H2/b7-3-,11-10+;;;; |
| InChIKey | XMJHKWDINBSECN-ZNDGVTCBSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|