C42H38 — CID 123779654
9,10-bis(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2,3-bis(ethenyl)anthracene (PubChem CID 123779654) has the molecular formula C42H38 and a molecular weight of 542.77 g/mol. Its IUPAC name is 9,10-bis(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2,3-bis(ethenyl)anthracene.
| Compound Name | 9,10-bis(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2,3-bis(ethenyl)anthracene |
|---|---|
| PubChem CID | 123779654 |
| Molecular Formula | C42H38 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 9,10-bis(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)-2,3-bis(ethenyl)anthracene |
| SMILES | C=CC=CC(=C)C(=C)C=CC(=C)c1c2ccccc2c(C(=C)C=CC(=C)C(=C)C=CC=C)c2cc(C=C)c(C=C)cc12 |
| InChI | InChI=1S/C42H38/c1-11-15-19-29(5)31(7)23-25-33(9)41-37-21-17-18-22-38(37)42(34(10)26-24-32(8)30(6)20-16-12-2)40-28-36(14-4)35(13-3)27-39(40)41/h11-28H,1-10H2 |
| InChIKey | OBIOZJOXYCQOFP-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|