About 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene
9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene (PubChem CID 145053371) has the molecular formula C20H12Br4
and a molecular weight of 571.93 g/mol. Its IUPAC name is 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene.
Molecular Properties
| Compound Name | 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene |
| PubChem CID | 145053371 |
| Molecular Formula | C20H12Br4 |
| Molecular Weight | 571.93 g/mol |
| Exact Mass | 567.77 |
| IUPAC Name | 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene |
| SMILES | C=Cc1cc2c(=C(Br)Br)c3ccccc3c(=C(Br)Br)c2cc1C=C |
| InChI | InChI=1S/C20H12Br4/c1-3-11-9-15-16(10-12(11)4-2)18(20(23)24)14-8-6-5-7-13(14)17(15)19(21)22/h3-10H,1-2H2 |
| InChIKey | FOOSPCTVBPSAOM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 571.93 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene?
The IUPAC name of 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene (CID 145053371) is 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene.
What is the SMILES notation for 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene?
The canonical SMILES for 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene is C=Cc1cc2c(=C(Br)Br)c3ccccc3c(=C(Br)Br)c2cc1C=C.
What is the InChIKey of 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene?
The InChIKey is FOOSPCTVBPSAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Br4/c1-3-11-9-15-16(10-12(11)4-2)18(20(23)24)14-8-6-5-7-13(14)17(15)19(21)22/h3-10H,1-2H2.
What are the key properties of 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene?
9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene has a molecular weight of 571.93 g/mol, XLogP of 6.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-bis(dibromomethylidene)-2,3-bis(ethenyl)anthracene is sourced from PubChem (CID 145053371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).