C25H18S — CID 129066637
(2Z)-4-(10-phenylanthracen-9-yl)penta-2,4-dienethial (PubChem CID 129066637) has the molecular formula C25H18S and a molecular weight of 350.49 g/mol. Its IUPAC name is (2Z)-4-(10-phenylanthracen-9-yl)penta-2,4-dienethial.
| Compound Name | (2Z)-4-(10-phenylanthracen-9-yl)penta-2,4-dienethial |
|---|---|
| PubChem CID | 129066637 |
| Molecular Formula | C25H18S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2Z)-4-(10-phenylanthracen-9-yl)penta-2,4-dienethial |
| SMILES | C=C(/C=C\C=S)c1c2ccccc2c(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H18S/c1-18(10-9-17-26)24-20-13-5-7-15-22(20)25(19-11-3-2-4-12-19)23-16-8-6-14-21(23)24/h2-17H,1H2/b10-9- |
| InChIKey | JXKCFTMSQAUEOS-KTKRTIGZSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|