C48H34OS — CID 130212716
(4E)-4-[(2E,5Z)-3-methyl-4-methylidene-7-(10-phenylanthracen-9-yl)octa-2,5,7-trienylidene]-20-oxa-3-thiapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),7,9,11,14,16,18-octaene (PubChem CID 130212716) has the molecular formula C48H34OS and a molecular weight of 658.87 g/mol. Its IUPAC name is (4E)-4-[(2E,5Z)-3-methyl-4-methylidene-7-(10-phenylanthracen-9-yl)octa-2,5,7-trienylidene]-20-oxa-3-thiapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),7,9,11,14,16,18-octaene.
| Compound Name | (4E)-4-[(2E,5Z)-3-methyl-4-methylidene-7-(10-phenylanthracen-9-yl)octa-2,5,7-trienylidene]-20-oxa-3-thiapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),7,9,11,14,16,18-octaene |
|---|---|
| PubChem CID | 130212716 |
| Molecular Formula | C48H34OS |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | (4E)-4-[(2E,5Z)-3-methyl-4-methylidene-7-(10-phenylanthracen-9-yl)octa-2,5,7-trienylidene]-20-oxa-3-thiapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(13),2(6),7,9,11,14,16,18-octaene |
| SMILES | C=C(/C=C\C(=C)c1c2ccccc2c(-c2ccccc2)c2ccccc12)/C(C)=C/C=C1\Cc2c(c3oc4ccccc4c3c3ccccc23)S1 |
| InChI | InChI=1S/C48H34OS/c1-30(25-26-32(3)44-37-19-9-11-21-39(37)45(33-15-5-4-6-16-33)40-22-12-10-20-38(40)44)31(2)27-28-34-29-42-35-17-7-8-18-36(35)46-41-23-13-14-24-43(41)49-47(46)48(42)50-34/h4-28H,1,3,29H2,2H3/b26-25-,31-27+,34-28+ |
| InChIKey | XWZIIQVVORFOQS-CCLNOWNISA-N |
| XLogP | 14.02 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|