C43H31NO — CID 142353580
ethene;(2Z)-1-naphtho[2,3-b][1]benzofuran-1-yl-4-(10-phenylanthracen-9-yl)penta-2,4-dien-1-imine (PubChem CID 142353580) has the molecular formula C43H31NO and a molecular weight of 577.73 g/mol. Its IUPAC name is ethene;(2Z)-1-naphtho[2,3-b][1]benzofuran-1-yl-4-(10-phenylanthracen-9-yl)penta-2,4-dien-1-imine.
| Compound Name | ethene;(2Z)-1-naphtho[2,3-b][1]benzofuran-1-yl-4-(10-phenylanthracen-9-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142353580 |
| Molecular Formula | C43H31NO |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | ethene;(2Z)-1-naphtho[2,3-b][1]benzofuran-1-yl-4-(10-phenylanthracen-9-yl)penta-2,4-dien-1-imine |
| SMILES | C=C.[H]/N=C(/C=C\C(=C)c1c2ccccc2c(-c2ccccc2)c2ccccc12)c1cccc2oc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C41H27NO.C2H4/c1-26(39-30-16-7-9-18-32(30)40(27-12-3-2-4-13-27)33-19-10-8-17-31(33)39)22-23-36(42)34-20-11-21-37-41(34)35-24-28-14-5-6-15-29(28)25-38(35)43-37;1-2/h2-25,42H,1H2;1-2H2/b23-22-,42-36-; |
| InChIKey | JWEKLHSTEHMRCM-IKDYXQQBSA-N |
| XLogP | 12.15 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|