C21H22O — CID 145321290
(3E,5Z,7Z)-1,1-diphenylnona-3,5,7-trien-1-ol (PubChem CID 145321290) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is (3E,5Z,7Z)-1,1-diphenylnona-3,5,7-trien-1-ol.
| Compound Name | (3E,5Z,7Z)-1,1-diphenylnona-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 145321290 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3E,5Z,7Z)-1,1-diphenylnona-3,5,7-trien-1-ol |
| SMILES | C/C=C\C=C/C=C/CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22O/c1-2-3-4-5-6-13-18-21(22,19-14-9-7-10-15-19)20-16-11-8-12-17-20/h2-17,22H,18H2,1H3/b3-2-,5-4-,13-6+ |
| InChIKey | RRCVRKSSFNNZJL-GRUVCEPESA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|