C21H24OS2 — CID 5369781
propan-2-yl (E)-6-hydroxy-6,6-diphenylhex-3-enedithioate (PubChem CID 5369781) has the molecular formula C21H24OS2 and a molecular weight of 356.56 g/mol. Its IUPAC name is propan-2-yl (E)-6-hydroxy-6,6-diphenylhex-3-enedithioate.
| Compound Name | propan-2-yl (E)-6-hydroxy-6,6-diphenylhex-3-enedithioate |
|---|---|
| PubChem CID | 5369781 |
| Molecular Formula | C21H24OS2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | propan-2-yl (E)-6-hydroxy-6,6-diphenylhex-3-enedithioate |
| SMILES | CC(C)SC(=S)C/C=C/CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24OS2/c1-17(2)24-20(23)15-9-10-16-21(22,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-14,17,22H,15-16H2,1-2H3/b10-9+ |
| InChIKey | RKWSHHLQJLDPND-MDZDMXLPSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|