C19H24ClNO — CID 171145453
5-(dimethylamino)-1,1-diphenylpent-3-en-1-ol;hydrochloride (PubChem CID 171145453) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 5-(dimethylamino)-1,1-diphenylpent-3-en-1-ol;hydrochloride.
| Compound Name | 5-(dimethylamino)-1,1-diphenylpent-3-en-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171145453 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 5-(dimethylamino)-1,1-diphenylpent-3-en-1-ol;hydrochloride |
| SMILES | CN(C)CC=CCC(O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO.ClH/c1-20(2)16-10-9-15-19(21,17-11-5-3-6-12-17)18-13-7-4-8-14-18;/h3-14,21H,15-16H2,1-2H3;1H |
| InChIKey | NDTLGWOLQPADOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|