C31H32O3 — CID 59962342
bis[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-phenylmethanol (PubChem CID 59962342) has the molecular formula C31H32O3 and a molecular weight of 452.59 g/mol. Its IUPAC name is bis[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-phenylmethanol.
| Compound Name | bis[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 59962342 |
| Molecular Formula | C31H32O3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | bis[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-phenylmethanol |
| SMILES | C/C=C/C=C/COc1ccc(C(O)(c2ccccc2)c2ccc(OC/C=C/C=C/C)cc2)cc1 |
| InChI | InChI=1S/C31H32O3/c1-3-5-7-12-24-33-29-20-16-27(17-21-29)31(32,26-14-10-9-11-15-26)28-18-22-30(23-19-28)34-25-13-8-6-4-2/h3-23,32H,24-25H2,1-2H3/b5-3+,6-4+,12-7+,13-8+ |
| InChIKey | FVXRDNLPRWYRPI-NOUMGUEKSA-N |
| XLogP | 6.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|