C13H16N2O2 — CID 20763416
N'-[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-N-hydroxymethanimidamide (PubChem CID 20763416) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N'-[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 20763416 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N'-[4-[(2E,4E)-hexa-2,4-dienoxy]phenyl]-N-hydroxymethanimidamide |
| SMILES | C/C=C/C=C/COc1ccc(/N=C/NO)cc1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-3-4-5-10-17-13-8-6-12(7-9-13)14-11-15-16/h2-9,11,16H,10H2,1H3,(H,14,15)/b3-2+,5-4+ |
| InChIKey | SGANCTWRCGUXFS-MQQKCMAXSA-N |
| XLogP | 2.84 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|