C16H18N2O2 — CID 20763545
N-hydroxy-N'-[4-(3-phenylpropoxy)phenyl]methanimidamide (PubChem CID 20763545) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-hydroxy-N'-[4-(3-phenylpropoxy)phenyl]methanimidamide.
| Compound Name | N-hydroxy-N'-[4-(3-phenylpropoxy)phenyl]methanimidamide |
|---|---|
| PubChem CID | 20763545 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-hydroxy-N'-[4-(3-phenylpropoxy)phenyl]methanimidamide |
| SMILES | ON/C=N/c1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O2/c19-18-13-17-15-8-10-16(11-9-15)20-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,13,19H,4,7,12H2,(H,17,18) |
| InChIKey | MIFAGVBMDJIPDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|