C17H21N3O2 — CID 59104061
N-hydroxy-N'-[6-(5-phenylpentoxy)-3-pyridinyl]methanimidamide (PubChem CID 59104061) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-hydroxy-N'-[6-(5-phenylpentoxy)-3-pyridinyl]methanimidamide.
| Compound Name | N-hydroxy-N'-[6-(5-phenylpentoxy)-3-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 59104061 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-hydroxy-N'-[6-(5-phenylpentoxy)-3-pyridinyl]methanimidamide |
| SMILES | ON/C=N/c1ccc(OCCCCCc2ccccc2)nc1 |
| InChI | InChI=1S/C17H21N3O2/c21-20-14-19-16-10-11-17(18-13-16)22-12-6-2-5-9-15-7-3-1-4-8-15/h1,3-4,7-8,10-11,13-14,21H,2,5-6,9,12H2,(H,19,20) |
| InChIKey | WYAYKMSEUMFYFX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|