C27H46O3Si2 — CID 11271463
(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-1-enyl]-2-methylcyclopentan-1-one (PubChem CID 11271463) has the molecular formula C27H46O3Si2 and a molecular weight of 474.83 g/mol. Its IUPAC name is (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-1-enyl]-2-methylcyclopentan-1-one.
| Compound Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-1-enyl]-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 11271463 |
| Molecular Formula | C27H46O3Si2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-1-enyl]-2-methylcyclopentan-1-one |
| SMILES | C[C@@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1/C=C/C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H46O3Si2/c1-20-22(25(19-23(20)28)30-32(10,11)27(5,6)7)17-18-24(21-15-13-12-14-16-21)29-31(8,9)26(2,3)4/h12-18,20,22,24-25H,19H2,1-11H3/b18-17+/t20-,22-,24?,25-/m0/s1 |
| InChIKey | DGNLAKRDYZPLHV-LMSUIMGQSA-N |
| XLogP | 7.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|