C34H53BrO2S — CID 156722658
[(5E,9E)-4-[(3E,7E)-9-bromo-2,3,7-trimethylnona-3,7-dien-2-yl]-6,10,11,11-tetramethyldodeca-5,9-dienyl]sulfonylbenzene (PubChem CID 156722658) has the molecular formula C34H53BrO2S and a molecular weight of 605.77 g/mol. Its IUPAC name is [(5E,9E)-4-[(3E,7E)-9-bromo-2,3,7-trimethylnona-3,7-dien-2-yl]-6,10,11,11-tetramethyldodeca-5,9-dienyl]sulfonylbenzene.
| Compound Name | [(5E,9E)-4-[(3E,7E)-9-bromo-2,3,7-trimethylnona-3,7-dien-2-yl]-6,10,11,11-tetramethyldodeca-5,9-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 156722658 |
| Molecular Formula | C34H53BrO2S |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | [(5E,9E)-4-[(3E,7E)-9-bromo-2,3,7-trimethylnona-3,7-dien-2-yl]-6,10,11,11-tetramethyldodeca-5,9-dienyl]sulfonylbenzene |
| SMILES | C/C(=C\CBr)CC/C=C(\C)C(C)(C)C(/C=C(\C)CC/C=C(\C)C(C)(C)C)CCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H53BrO2S/c1-27(23-24-35)16-13-19-30(4)34(8,9)31(26-28(2)17-14-18-29(3)33(5,6)7)20-15-25-38(36,37)32-21-11-10-12-22-32/h10-12,18-19,21-23,26,31H,13-17,20,24-25H2,1-9H3/b27-23+,28-26+,29-18+,30-19+ |
| InChIKey | KFFOQYJYWQAJII-BZJXYLBVSA-N |
| XLogP | 10.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|