C55H110O6SSi4 — CID 11412090
[(2R,6R,10S,14S)-2-[2-(benzenesulfonyl)ethyl]-6,10,14,18-tetramethyl-6,10,14-tris(triethylsilyloxy)nonadec-17-en-2-yl]oxy-triethylsilane (PubChem CID 11412090) has the molecular formula C55H110O6SSi4 and a molecular weight of 1011.89 g/mol. Its IUPAC name is [(2R,6R,10S,14S)-2-[2-(benzenesulfonyl)ethyl]-6,10,14,18-tetramethyl-6,10,14-tris(triethylsilyloxy)nonadec-17-en-2-yl]oxy-triethylsilane.
| Compound Name | [(2R,6R,10S,14S)-2-[2-(benzenesulfonyl)ethyl]-6,10,14,18-tetramethyl-6,10,14-tris(triethylsilyloxy)nonadec-17-en-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11412090 |
| Molecular Formula | C55H110O6SSi4 |
| Molecular Weight | 1011.89 g/mol |
| Exact Mass | 1010.71 |
| IUPAC Name | [(2R,6R,10S,14S)-2-[2-(benzenesulfonyl)ethyl]-6,10,14,18-tetramethyl-6,10,14-tris(triethylsilyloxy)nonadec-17-en-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@](C)(CCC[C@](C)(CCC[C@](C)(CCS(=O)(=O)c1ccccc1)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)CCC[C@@](C)(CCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C55H110O6SSi4/c1-19-63(20-2,21-3)58-52(15,41-34-38-50(13)14)42-35-43-53(16,59-64(22-4,23-5)24-6)44-36-45-54(17,60-65(25-7,26-8)27-9)46-37-47-55(18,61-66(28-10,29-11)30-12)48-49-62(56,57)51-39-32-31-33-40-51/h31-33,38-40H,19-30,34-37,41-49H2,1-18H3/t52-,53-,54-,55-/m1/s1 |
| InChIKey | WDFCOSOKTWEHED-IEUCTDKYSA-N |
| XLogP | 18.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.89 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|