C34H50O5SSi2 — CID 11767344
(3S,5S)-7-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-5-methyl-8-trimethylsilyloctane-3,5-diol (PubChem CID 11767344) has the molecular formula C34H50O5SSi2 and a molecular weight of 627.01 g/mol. Its IUPAC name is (3S,5S)-7-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-5-methyl-8-trimethylsilyloctane-3,5-diol.
| Compound Name | (3S,5S)-7-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-5-methyl-8-trimethylsilyloctane-3,5-diol |
|---|---|
| PubChem CID | 11767344 |
| Molecular Formula | C34H50O5SSi2 |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | (3S,5S)-7-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-5-methyl-8-trimethylsilyloctane-3,5-diol |
| SMILES | CC(C)(C)[Si](OCC[C@H](O)C[C@](C)(O)CC(C[Si](C)(C)C)S(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H50O5SSi2/c1-33(2,3)42(31-19-13-9-14-20-31,32-21-15-10-16-22-32)39-24-23-28(35)25-34(4,36)26-30(27-41(5,6)7)40(37,38)29-17-11-8-12-18-29/h8-22,28,30,35-36H,23-27H2,1-7H3/t28-,30?,34-/m0/s1 |
| InChIKey | NELFJBFRVDXZGG-ZPZSBFEASA-N |
| XLogP | 6.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|