C31H40O6SSi — CID 134844713
[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxyoxolan-2-yl]methanol (PubChem CID 134844713) has the molecular formula C31H40O6SSi and a molecular weight of 568.81 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxyoxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 134844713 |
| Molecular Formula | C31H40O6SSi |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | [(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxyoxolan-2-yl]methanol |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]1CO |
| InChI | InChI=1S/C31H40O6SSi/c1-31(2,3)39(25-16-10-6-11-17-25,26-18-12-7-13-19-26)36-21-20-28-27(30(35-4)29(22-32)37-28)23-38(33,34)24-14-8-5-9-15-24/h5-19,27-30,32H,20-23H2,1-4H3/t27-,28-,29+,30+/m0/s1 |
| InChIKey | AJVFHTFNYHJIJA-VZNYXHRGSA-N |
| XLogP | 3.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|