C28H34O4SSi — CID 134937816
[1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 134937816) has the molecular formula C28H34O4SSi and a molecular weight of 494.73 g/mol. Its IUPAC name is [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134937816 |
| Molecular Formula | C28H34O4SSi |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H34O4SSi/c1-21(2)25(26-27(31-26)33(29,30)22-15-9-6-10-16-22)32-34(28(3,4)5,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-21,25-27H,1-5H3/t25?,26-,27-/m1/s1 |
| InChIKey | FXUBSTAKOUHYEY-NODVFIEMSA-N |
| XLogP | 4.79 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|