C26H32O3SSi — CID 10994068
[(2R)-3-(benzenesulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 10994068) has the molecular formula C26H32O3SSi and a molecular weight of 452.69 g/mol. Its IUPAC name is [(2R)-3-(benzenesulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-3-(benzenesulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10994068 |
| Molecular Formula | C26H32O3SSi |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(2R)-3-(benzenesulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H32O3SSi/c1-22(21-30(27,28)23-14-8-5-9-15-23)20-29-31(26(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22H,20-21H2,1-4H3/t22-/m1/s1 |
| InChIKey | AVTFNWJNRSUTBJ-JOCHJYFZSA-N |
| XLogP | 4.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|