C28H34O2SSi — CID 10863530
tert-butyl-[(Z,4S)-4-methyl-5-[(R)-phenylsulfinyl]pent-2-enoxy]-diphenylsilane (PubChem CID 10863530) has the molecular formula C28H34O2SSi and a molecular weight of 462.73 g/mol. Its IUPAC name is tert-butyl-[(Z,4S)-4-methyl-5-[(R)-phenylsulfinyl]pent-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z,4S)-4-methyl-5-[(R)-phenylsulfinyl]pent-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10863530 |
| Molecular Formula | C28H34O2SSi |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | tert-butyl-[(Z,4S)-4-methyl-5-[(R)-phenylsulfinyl]pent-2-enoxy]-diphenylsilane |
| SMILES | C[C@@H](/C=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C28H34O2SSi/c1-24(23-31(29)25-16-8-5-9-17-25)15-14-22-30-32(28(2,3)4,26-18-10-6-11-19-26)27-20-12-7-13-21-27/h5-21,24H,22-23H2,1-4H3/b15-14-/t24-,31+/m0/s1 |
| InChIKey | YJHFZDKKXCVBSM-PDRRCWKTSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|