C30H30O3SSi — CID 15935891
[(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-triphenylsilane (PubChem CID 15935891) has the molecular formula C30H30O3SSi and a molecular weight of 498.72 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-triphenylsilane.
| Compound Name | [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-triphenylsilane |
|---|---|
| PubChem CID | 15935891 |
| Molecular Formula | C30H30O3SSi |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-triphenylsilane |
| SMILES | CC(C)C(/C=C/S(=O)(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30O3SSi/c1-25(2)30(23-24-34(31,32)26-15-7-3-8-16-26)33-35(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-25,30H,1-2H3/b24-23+ |
| InChIKey | PMCJCFMSKQFXNU-WCWDXBQESA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|