C30H34O2SSi — CID 134972263
[(2Z)-6-(benzenesulfinyl)octa-2,6,7-trienoxy]-tert-butyl-diphenylsilane (PubChem CID 134972263) has the molecular formula C30H34O2SSi and a molecular weight of 486.75 g/mol. Its IUPAC name is [(2Z)-6-(benzenesulfinyl)octa-2,6,7-trienoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2Z)-6-(benzenesulfinyl)octa-2,6,7-trienoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134972263 |
| Molecular Formula | C30H34O2SSi |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | [(2Z)-6-(benzenesulfinyl)octa-2,6,7-trienoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C=C(CC/C=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)c1ccccc1 |
| InChI | InChI=1S/C30H34O2SSi/c1-5-26(33(31)27-19-10-6-11-20-27)18-12-9-17-25-32-34(30(2,3)4,28-21-13-7-14-22-28)29-23-15-8-16-24-29/h6-11,13-17,19-24H,1,12,18,25H2,2-4H3/b17-9- |
| InChIKey | CATJCLCBINUBTC-MFOYZWKCSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|