C26H33NO2SSi — CID 25038737
(2R)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]butan-2-ol (PubChem CID 25038737) has the molecular formula C26H33NO2SSi and a molecular weight of 451.71 g/mol. Its IUPAC name is (2R)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]butan-2-ol.
| Compound Name | (2R)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]butan-2-ol |
|---|---|
| PubChem CID | 25038737 |
| Molecular Formula | C26H33NO2SSi |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (2R)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]butan-2-ol |
| SMILES | CC[C@@H](O)C[S@](=O)(=N[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H33NO2SSi/c1-5-22(28)21-30(29,23-15-9-6-10-16-23)27-31(26(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,28H,5,21H2,1-4H3/t22-,30-/m1/s1 |
| InChIKey | HVVSZJIXFYCJMH-YKGWIAGDSA-N |
| XLogP | 4.84 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|