C29H36O4SSi — CID 10696994
(Z,3S,4R)-6-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-5-en-3-ol (PubChem CID 10696994) has the molecular formula C29H36O4SSi and a molecular weight of 508.76 g/mol. Its IUPAC name is (Z,3S,4R)-6-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-5-en-3-ol.
| Compound Name | (Z,3S,4R)-6-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10696994 |
| Molecular Formula | C29H36O4SSi |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (Z,3S,4R)-6-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-5-en-3-ol |
| SMILES | C[C@H](/C=C\S(=O)(=O)c1ccccc1)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O4SSi/c1-24(21-23-34(31,32)25-14-8-5-9-15-25)28(30)20-22-33-35(29(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,21,23-24,28,30H,20,22H2,1-4H3/b23-21-/t24-,28+/m1/s1 |
| InChIKey | IVGJASXZMYZSLC-RMAQSYCSSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|