C30H38O4SSi — CID 11060415
(4S,5R,6S)-7-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhept-1-en-4-ol (PubChem CID 11060415) has the molecular formula C30H38O4SSi and a molecular weight of 522.78 g/mol. Its IUPAC name is (4S,5R,6S)-7-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhept-1-en-4-ol.
| Compound Name | (4S,5R,6S)-7-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 11060415 |
| Molecular Formula | C30H38O4SSi |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (4S,5R,6S)-7-(benzenesulfonyl)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhept-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@@H](C)[C@@H](CS(=O)(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O4SSi/c1-6-16-28(31)24(2)29(23-35(32,33)25-17-10-7-11-18-25)34-36(30(3,4)5,26-19-12-8-13-20-26)27-21-14-9-15-22-27/h6-15,17-22,24,28-29,31H,1,16,23H2,2-5H3/t24-,28+,29-/m1/s1 |
| InChIKey | UAHLZPDPHZBVCD-OFQAEJFBSA-N |
| XLogP | 4.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|