C27H35NO2SSi — CID 25038742
(2S)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-3-methylbutan-2-ol (PubChem CID 25038742) has the molecular formula C27H35NO2SSi and a molecular weight of 465.74 g/mol. Its IUPAC name is (2S)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-3-methylbutan-2-ol.
| Compound Name | (2S)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 25038742 |
| Molecular Formula | C27H35NO2SSi |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (2S)-1-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-3-methylbutan-2-ol |
| SMILES | CC(C)[C@H](O)C[S@](=O)(=N[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H35NO2SSi/c1-22(2)26(29)21-31(30,23-15-9-6-10-16-23)28-32(27(3,4)5,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,26,29H,21H2,1-5H3/t26-,31-/m1/s1 |
| InChIKey | BXXNSTUIMNWDOM-MXBOTTGLSA-N |
| XLogP | 5.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|