C28H35BrO3SSi — CID 134934763
(2R,3S,4S)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-[(S)-phenylsulfinyl]pentan-3-ol (PubChem CID 134934763) has the molecular formula C28H35BrO3SSi and a molecular weight of 559.64 g/mol. Its IUPAC name is (2R,3S,4S)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-[(S)-phenylsulfinyl]pentan-3-ol.
| Compound Name | (2R,3S,4S)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-[(S)-phenylsulfinyl]pentan-3-ol |
|---|---|
| PubChem CID | 134934763 |
| Molecular Formula | C28H35BrO3SSi |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | (2R,3S,4S)-2-bromo-1-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-[(S)-phenylsulfinyl]pentan-3-ol |
| SMILES | C[C@H](C[S@](=O)c1ccccc1)[C@H](O)[C@H](Br)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H35BrO3SSi/c1-22(21-33(31)23-14-8-5-9-15-23)27(30)26(29)20-32-34(28(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22,26-27,30H,20-21H2,1-4H3/t22-,26-,27+,33+/m1/s1 |
| InChIKey | SSTYHMFQHOYDSW-LIMSVMPOSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|